C23H29F3N2O2 — CID 71222188
(2S,3'R)-1-methyl-3'-(oxan-4-ylamino)-8-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one (PubChem CID 71222188) has the molecular formula C23H29F3N2O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is (2S,3'R)-1-methyl-3'-(oxan-4-ylamino)-8-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one.
| Compound Name | (2S,3'R)-1-methyl-3'-(oxan-4-ylamino)-8-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one |
|---|---|
| PubChem CID | 71222188 |
| Molecular Formula | C23H29F3N2O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | (2S,3'R)-1-methyl-3'-(oxan-4-ylamino)-8-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one |
| SMILES | CC1C2Cc3cc(C(F)(F)F)ccc3CN2C(=O)[C@]12CC[C@@H](NC1CCOCC1)C2 |
| InChI | InChI=1S/C23H29F3N2O2/c1-14-20-11-16-10-17(23(24,25)26)3-2-15(16)13-28(20)21(29)22(14)7-4-19(12-22)27-18-5-8-30-9-6-18/h2-3,10,14,18-20,27H,4-9,11-13H2,1H3/t14?,19-,20?,22+/m1/s1 |
| InChIKey | WQWAQXXNCNBOMQ-NLSRQCNQSA-N |
| XLogP | 3.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |