C24H31F3N2O2 — CID 162580384
(2S)-1-methyl-3'-[[(3S,4S)-3-methyloxan-4-yl]amino]-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one (PubChem CID 162580384) has the molecular formula C24H31F3N2O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is (2S)-1-methyl-3'-[[(3S,4S)-3-methyloxan-4-yl]amino]-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one.
| Compound Name | (2S)-1-methyl-3'-[[(3S,4S)-3-methyloxan-4-yl]amino]-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one |
|---|---|
| PubChem CID | 162580384 |
| Molecular Formula | C24H31F3N2O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | (2S)-1-methyl-3'-[[(3S,4S)-3-methyloxan-4-yl]amino]-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one |
| SMILES | CC1C2Cc3ccc(C(F)(F)F)cc3CN2C(=O)[C@]12CCC(N[C@H]1CCOC[C@H]1C)C2 |
| InChI | InChI=1S/C24H31F3N2O2/c1-14-13-31-8-6-20(14)28-19-5-7-23(11-19)15(2)21-10-16-3-4-18(24(25,26)27)9-17(16)12-29(21)22(23)30/h3-4,9,14-15,19-21,28H,5-8,10-13H2,1-2H3/t14-,15?,19?,20+,21?,23+/m1/s1 |
| InChIKey | LEZWHLIIZYMEIS-MTKPTVMTSA-N |
| XLogP | 4.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |