C21H23N4O2S- — CID 70872179
2-piperidin-1-yl-7-[4-[2-(sulfinatoamino)ethyl]phenyl]quinoxaline (PubChem CID 70872179) has the molecular formula C21H23N4O2S- and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-piperidin-1-yl-7-[4-[2-(sulfinatoamino)ethyl]phenyl]quinoxaline.
| Compound Name | 2-piperidin-1-yl-7-[4-[2-(sulfinatoamino)ethyl]phenyl]quinoxaline |
|---|---|
| PubChem CID | 70872179 |
| Molecular Formula | C21H23N4O2S- |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-piperidin-1-yl-7-[4-[2-(sulfinatoamino)ethyl]phenyl]quinoxaline |
| SMILES | O=S([O-])NCCc1ccc(-c2ccc3ncc(N4CCCCC4)nc3c2)cc1 |
| InChI | InChI=1S/C21H24N4O2S/c26-28(27)23-11-10-16-4-6-17(7-5-16)18-8-9-19-20(14-18)24-21(15-22-19)25-12-2-1-3-13-25/h4-9,14-15,23H,1-3,10-13H2,(H,26,27)/p-1 |
| InChIKey | SMDHMLFAVSQHKT-UHFFFAOYSA-M |
| XLogP | 3.21 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|