C29H26N3O4+ — CID 70875903
9-(3H-benzimidazol-5-yl)-2,3,7,8-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium (PubChem CID 70875903) has the molecular formula C29H26N3O4+ and a molecular weight of 480.54 g/mol. Its IUPAC name is 9-(3H-benzimidazol-5-yl)-2,3,7,8-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium.
| Compound Name | 9-(3H-benzimidazol-5-yl)-2,3,7,8-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium |
|---|---|
| PubChem CID | 70875903 |
| Molecular Formula | C29H26N3O4+ |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 9-(3H-benzimidazol-5-yl)-2,3,7,8-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium |
| SMILES | COc1cc2ccc3c4cc(-c5ccc6nc[nH]c6c5)c(OC)c(OC)c4c[n+](C)c3c2cc1OC |
| InChI | InChI=1S/C29H25N3O4/c1-32-14-22-21(18-8-6-17-11-25(33-2)26(34-3)13-19(17)27(18)32)12-20(28(35-4)29(22)36-5)16-7-9-23-24(10-16)31-15-30-23/h6-15H,1-5H3/p+1 |
| InChIKey | JHFVVXNKEYYXNL-UHFFFAOYSA-O |
| XLogP | 5.55 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|