C15H28N2O3 — CID 70887515
tert-butyl 2-(3,3-dimethylbutanoyl)diazinane-1-carboxylate (PubChem CID 70887515) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is tert-butyl 2-(3,3-dimethylbutanoyl)diazinane-1-carboxylate.
| Compound Name | tert-butyl 2-(3,3-dimethylbutanoyl)diazinane-1-carboxylate |
|---|---|
| PubChem CID | 70887515 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | tert-butyl 2-(3,3-dimethylbutanoyl)diazinane-1-carboxylate |
| SMILES | CC(C)(C)CC(=O)N1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28N2O3/c1-14(2,3)11-12(18)16-9-7-8-10-17(16)13(19)20-15(4,5)6/h7-11H2,1-6H3 |
| InChIKey | BFCUDZIQVGHPBG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |