C28H34FN5O3S — CID 70892160
(6E,9aS)-8-(2-benzylsulfanylethyl)-N-[(4-fluorophenyl)methyl]-2-methyl-6-(2-methylpropylidene)-4,7-dioxo-9,9a-dihydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 70892160) has the molecular formula C28H34FN5O3S and a molecular weight of 539.68 g/mol. Its IUPAC name is (6E,9aS)-8-(2-benzylsulfanylethyl)-N-[(4-fluorophenyl)methyl]-2-methyl-6-(2-methylpropylidene)-4,7-dioxo-9,9a-dihydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6E,9aS)-8-(2-benzylsulfanylethyl)-N-[(4-fluorophenyl)methyl]-2-methyl-6-(2-methylpropylidene)-4,7-dioxo-9,9a-dihydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 70892160 |
| Molecular Formula | C28H34FN5O3S |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | (6E,9aS)-8-(2-benzylsulfanylethyl)-N-[(4-fluorophenyl)methyl]-2-methyl-6-(2-methylpropylidene)-4,7-dioxo-9,9a-dihydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CC(C)/C=C1\C(=O)N(CCSCc2ccccc2)C[C@H]2N1C(=O)CN(C)N2C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C28H34FN5O3S/c1-20(2)15-24-27(36)32(13-14-38-19-22-7-5-4-6-8-22)17-25-33(24)26(35)18-31(3)34(25)28(37)30-16-21-9-11-23(29)12-10-21/h4-12,15,20,25H,13-14,16-19H2,1-3H3,(H,30,37)/b24-15+/t25-/m0/s1 |
| InChIKey | GMUSNCCVWPDGHX-VVIXHQMUSA-N |
| XLogP | 3.67 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|