C14H18O4 — CID 70920304
(3S,4R)-3-phenylmethoxy-6-oxabicyclo[3.2.1]octane-2,4-diol (PubChem CID 70920304) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (3S,4R)-3-phenylmethoxy-6-oxabicyclo[3.2.1]octane-2,4-diol.
| Compound Name | (3S,4R)-3-phenylmethoxy-6-oxabicyclo[3.2.1]octane-2,4-diol |
|---|---|
| PubChem CID | 70920304 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (3S,4R)-3-phenylmethoxy-6-oxabicyclo[3.2.1]octane-2,4-diol |
| SMILES | OC1C2COC(C2)[C@@H](O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C14H18O4/c15-12-10-6-11(17-8-10)13(16)14(12)18-7-9-4-2-1-3-5-9/h1-5,10-16H,6-8H2/t10?,11?,12?,13-,14+/m1/s1 |
| InChIKey | FFKSRBDNLQJPFJ-JJRYREJMSA-N |
| XLogP | 0.71 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |