C21H34F3N3O3 — CID 70933419
tert-butyl 4-oxo-2-(9,9,9-trifluorononyl)-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate (PubChem CID 70933419) has the molecular formula C21H34F3N3O3 and a molecular weight of 433.52 g/mol. Its IUPAC name is tert-butyl 4-oxo-2-(9,9,9-trifluorononyl)-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate.
| Compound Name | tert-butyl 4-oxo-2-(9,9,9-trifluorononyl)-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate |
|---|---|
| PubChem CID | 70933419 |
| Molecular Formula | C21H34F3N3O3 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | tert-butyl 4-oxo-2-(9,9,9-trifluorononyl)-1,3,8-triazaspiro[4.5]dec-1-ene-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)N=C(CCCCCCCCC(F)(F)F)NC2=O |
| InChI | InChI=1S/C21H34F3N3O3/c1-19(2,3)30-18(29)27-14-12-20(13-15-27)17(28)25-16(26-20)10-8-6-4-5-7-9-11-21(22,23)24/h4-15H2,1-3H3,(H,25,26,28) |
| InChIKey | IIGFFZUBSLKWLC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|