C19H29N3O2S — CID 70938753
N-[5-(isoquinolin-1-ylmethylamino)pentyl]-2-methylpropane-2-sulfonamide (PubChem CID 70938753) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is N-[5-(isoquinolin-1-ylmethylamino)pentyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[5-(isoquinolin-1-ylmethylamino)pentyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 70938753 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-[5-(isoquinolin-1-ylmethylamino)pentyl]-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)NCCCCCNCc1nccc2ccccc12 |
| InChI | InChI=1S/C19H29N3O2S/c1-19(2,3)25(23,24)22-13-8-4-7-12-20-15-18-17-10-6-5-9-16(17)11-14-21-18/h5-6,9-11,14,20,22H,4,7-8,12-13,15H2,1-3H3 |
| InChIKey | ISPDHCGBLKORDH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|