C16H27F2N3O10 — CID 70948604
(2S)-2-[[(2S)-2-amino-5-[[2-[(2R,3R,4R,5S)-5-(1,2-dihydroxyethyl)-2,3,4-trihydroxyoxolan-2-yl]-2,2-difluoroacetyl]amino]pentanoyl]amino]propanoic acid (PubChem CID 70948604) has the molecular formula C16H27F2N3O10 and a molecular weight of 459.40 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-5-[[2-[(2R,3R,4R,5S)-5-(1,2-dihydroxyethyl)-2,3,4-trihydroxyoxolan-2-yl]-2,2-difluoroacetyl]amino]pentanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-5-[[2-[(2R,3R,4R,5S)-5-(1,2-dihydroxyethyl)-2,3,4-trihydroxyoxolan-2-yl]-2,2-difluoroacetyl]amino]pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70948604 |
| Molecular Formula | C16H27F2N3O10 |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-5-[[2-[(2R,3R,4R,5S)-5-(1,2-dihydroxyethyl)-2,3,4-trihydroxyoxolan-2-yl]-2,2-difluoroacetyl]amino]pentanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@@H](N)CCCNC(=O)C(F)(F)[C@]1(O)O[C@@H](C(O)CO)[C@H](O)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C16H27F2N3O10/c1-6(13(27)28)21-12(26)7(19)3-2-4-20-14(29)15(17,18)16(30)11(25)9(24)10(31-16)8(23)5-22/h6-11,22-25,30H,2-5,19H2,1H3,(H,20,29)(H,21,26)(H,27,28)/t6-,7-,8?,9-,10-,11+,16+/m0/s1 |
| InChIKey | CPVSQOOVOKNBJA-GFNLPNCUSA-N |
| XLogP | -4.40 |
| TPSA | 231.90 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|