C23H29N9 — CID 70991587
3-N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,12-pentaen-5-yl)-6-N-(pyrrolidin-3-ylmethyl)pyridazine-3,6-diamine (PubChem CID 70991587) has the molecular formula C23H29N9 and a molecular weight of 431.55 g/mol. Its IUPAC name is 3-N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,12-pentaen-5-yl)-6-N-(pyrrolidin-3-ylmethyl)pyridazine-3,6-diamine.
| Compound Name | 3-N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,12-pentaen-5-yl)-6-N-(pyrrolidin-3-ylmethyl)pyridazine-3,6-diamine |
|---|---|
| PubChem CID | 70991587 |
| Molecular Formula | C23H29N9 |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 3-N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,12-pentaen-5-yl)-6-N-(pyrrolidin-3-ylmethyl)pyridazine-3,6-diamine |
| SMILES | C1=Cc2c(n(C3CCCC3)c3nc(Nc4ccc(NCC5CCNC5)nn4)ncc23)CN1 |
| InChI | InChI=1S/C23H29N9/c1-2-4-16(3-1)32-19-14-25-10-8-17(19)18-13-27-23(29-22(18)32)28-21-6-5-20(30-31-21)26-12-15-7-9-24-11-15/h5-6,8,10,13,15-16,24-25H,1-4,7,9,11-12,14H2,(H,26,30)(H,27,28,29,31) |
| InChIKey | LVIZCFKDDXXPBW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |