C24H28N8 — CID 58300178
2-N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)-5-N-(pyrrolidin-3-ylmethyl)pyridine-2,5-diamine (PubChem CID 58300178) has the molecular formula C24H28N8 and a molecular weight of 428.54 g/mol. Its IUPAC name is 2-N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)-5-N-(pyrrolidin-3-ylmethyl)pyridine-2,5-diamine.
| Compound Name | 2-N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)-5-N-(pyrrolidin-3-ylmethyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 58300178 |
| Molecular Formula | C24H28N8 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 2-N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)-5-N-(pyrrolidin-3-ylmethyl)pyridine-2,5-diamine |
| SMILES | c1cc2c3cnc(Nc4ccc(NCC5CCNC5)cn4)nc3n(C3CCCC3)c2cn1 |
| InChI | InChI=1S/C24H28N8/c1-2-4-18(3-1)32-21-15-26-10-8-19(21)20-14-29-24(31-23(20)32)30-22-6-5-17(13-28-22)27-12-16-7-9-25-11-16/h5-6,8,10,13-16,18,25,27H,1-4,7,9,11-12H2,(H,28,29,30,31) |
| InChIKey | AADALVDVXCAFCH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |