C17H22F3N3O4S — CID 71003210
N-[(6R,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-2-methylpropane-1-sulfonamide (PubChem CID 71003210) has the molecular formula C17H22F3N3O4S and a molecular weight of 421.44 g/mol. Its IUPAC name is N-[(6R,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-2-methylpropane-1-sulfonamide.
| Compound Name | N-[(6R,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 71003210 |
| Molecular Formula | C17H22F3N3O4S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N-[(6R,7aS)-3-oxo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-6-yl]-2-methylpropane-1-sulfonamide |
| SMILES | CC(C)CS(=O)(=O)N[C@@H]1C[C@H]2CN(c3ccc(OC(F)(F)F)cc3)C(=O)N2C1 |
| InChI | InChI=1S/C17H22F3N3O4S/c1-11(2)10-28(25,26)21-12-7-14-9-23(16(24)22(14)8-12)13-3-5-15(6-4-13)27-17(18,19)20/h3-6,11-12,14,21H,7-10H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | WLROKZSWFFYSGB-OCCSQVGLSA-N |
| XLogP | 2.54 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |