C31H28Cl2FN3O4 — CID 71020668
CID 71020668 (PubChem CID 71020668) has the molecular formula C31H28Cl2FN3O4 and a molecular weight of 596.49 g/mol.
| Compound Name | CID 71020668 |
|---|---|
| PubChem CID | 71020668 |
| Molecular Formula | C31H28Cl2FN3O4 |
| Molecular Weight | 596.49 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccc(CNC(=O)[C@@H]2NC3(CCCCC3)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2cccc(Cl)c2F)cc1 |
| InChI | InChI=1S/C31H28Cl2FN3O4/c32-19-11-12-21-23(15-19)36-29(41)31(21)24(20-5-4-6-22(33)25(20)34)26(37-30(31)13-2-1-3-14-30)27(38)35-16-17-7-9-18(10-8-17)28(39)40/h4-12,15,24,26,37H,1-3,13-14,16H2,(H,35,38)(H,36,41)(H,39,40)/t24-,26+,31+/m0/s1 |
| InChIKey | YGDUAQBHMIIUNT-UZXRVZLOSA-N |
| XLogP | 5.80 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |