C24H24Cl2N2O — CID 71021288
4-[(2R)-4-benzyl-2-(4-chlorophenyl)-6-methylpiperazin-1-yl]-3-chlorophenol (PubChem CID 71021288) has the molecular formula C24H24Cl2N2O and a molecular weight of 427.38 g/mol. Its IUPAC name is 4-[(2R)-4-benzyl-2-(4-chlorophenyl)-6-methylpiperazin-1-yl]-3-chlorophenol.
| Compound Name | 4-[(2R)-4-benzyl-2-(4-chlorophenyl)-6-methylpiperazin-1-yl]-3-chlorophenol |
|---|---|
| PubChem CID | 71021288 |
| Molecular Formula | C24H24Cl2N2O |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 4-[(2R)-4-benzyl-2-(4-chlorophenyl)-6-methylpiperazin-1-yl]-3-chlorophenol |
| SMILES | CC1CN(Cc2ccccc2)C[C@@H](c2ccc(Cl)cc2)N1c1ccc(O)cc1Cl |
| InChI | InChI=1S/C24H24Cl2N2O/c1-17-14-27(15-18-5-3-2-4-6-18)16-24(19-7-9-20(25)10-8-19)28(17)23-12-11-21(29)13-22(23)26/h2-13,17,24,29H,14-16H2,1H3/t17?,24-/m0/s1 |
| InChIKey | PMINRQWXHVUZJC-UCSBTNPJSA-N |
| XLogP | 6.15 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |