C32H33FO — CID 71021734
4-[(1R)-1-[4-[2-(3-fluoro-4-methylphenyl)propan-2-yl]phenyl]-1-(3-methylphenyl)ethyl]-2-methylphenol (PubChem CID 71021734) has the molecular formula C32H33FO and a molecular weight of 452.61 g/mol. Its IUPAC name is 4-[(1R)-1-[4-[2-(3-fluoro-4-methylphenyl)propan-2-yl]phenyl]-1-(3-methylphenyl)ethyl]-2-methylphenol.
| Compound Name | 4-[(1R)-1-[4-[2-(3-fluoro-4-methylphenyl)propan-2-yl]phenyl]-1-(3-methylphenyl)ethyl]-2-methylphenol |
|---|---|
| PubChem CID | 71021734 |
| Molecular Formula | C32H33FO |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 4-[(1R)-1-[4-[2-(3-fluoro-4-methylphenyl)propan-2-yl]phenyl]-1-(3-methylphenyl)ethyl]-2-methylphenol |
| SMILES | Cc1cccc([C@@](C)(c2ccc(C(C)(C)c3ccc(C)c(F)c3)cc2)c2ccc(O)c(C)c2)c1 |
| InChI | InChI=1S/C32H33FO/c1-21-8-7-9-27(18-21)32(6,28-16-17-30(34)23(3)19-28)25-14-12-24(13-15-25)31(4,5)26-11-10-22(2)29(33)20-26/h7-20,34H,1-6H3/t32-/m1/s1 |
| InChIKey | WVDFEUVBXOQEDR-JGCGQSQUSA-N |
| XLogP | 8.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|