C28H17Br2NO2S — CID 71022559
(Z)-2-cyano-3-[3,4-dibromo-5-[4-(2,2-diphenylethenyl)phenyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 71022559) has the molecular formula C28H17Br2NO2S and a molecular weight of 591.32 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3,4-dibromo-5-[4-(2,2-diphenylethenyl)phenyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[3,4-dibromo-5-[4-(2,2-diphenylethenyl)phenyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71022559 |
| Molecular Formula | C28H17Br2NO2S |
| Molecular Weight | 591.32 g/mol |
| Exact Mass | 588.93 |
| IUPAC Name | (Z)-2-cyano-3-[3,4-dibromo-5-[4-(2,2-diphenylethenyl)phenyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | N#C/C(=C/c1sc(-c2ccc(C=C(c3ccccc3)c3ccccc3)cc2)c(Br)c1Br)C(=O)O |
| InChI | InChI=1S/C28H17Br2NO2S/c29-25-24(16-22(17-31)28(32)33)34-27(26(25)30)21-13-11-18(12-14-21)15-23(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-16H,(H,32,33)/b22-16- |
| InChIKey | UYBUAUQPORNZSU-JWGURIENSA-N |
| XLogP | 8.52 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.32 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|