C26H30N2 — CID 71022678
3-[(1S,3'R)-3'-methylspiro[3a,7a-dihydroindene-1,4'-piperidine]-1'-yl]-1-phenylcyclopentane-1-carbonitrile (PubChem CID 71022678) has the molecular formula C26H30N2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 3-[(1S,3'R)-3'-methylspiro[3a,7a-dihydroindene-1,4'-piperidine]-1'-yl]-1-phenylcyclopentane-1-carbonitrile.
| Compound Name | 3-[(1S,3'R)-3'-methylspiro[3a,7a-dihydroindene-1,4'-piperidine]-1'-yl]-1-phenylcyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 71022678 |
| Molecular Formula | C26H30N2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 3-[(1S,3'R)-3'-methylspiro[3a,7a-dihydroindene-1,4'-piperidine]-1'-yl]-1-phenylcyclopentane-1-carbonitrile |
| SMILES | C[C@H]1CN(C2CCC(C#N)(c3ccccc3)C2)CC[C@@]12C=CC1C=CC=CC12 |
| InChI | InChI=1S/C26H30N2/c1-20-18-28(16-15-26(20)14-11-21-7-5-6-10-24(21)26)23-12-13-25(17-23,19-27)22-8-3-2-4-9-22/h2-11,14,20-21,23-24H,12-13,15-18H2,1H3/t20-,21?,23?,24?,25?,26-/m0/s1 |
| InChIKey | PBNJTIIPRGAODA-ZXBYJGQXSA-N |
| XLogP | 5.26 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|