C26H30N2O — CID 71032167
(13S,17R)-17-hydroxy-4,13-dimethyl-17-(pyridin-4-ylmethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carbonitrile (PubChem CID 71032167) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is (13S,17R)-17-hydroxy-4,13-dimethyl-17-(pyridin-4-ylmethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carbonitrile.
| Compound Name | (13S,17R)-17-hydroxy-4,13-dimethyl-17-(pyridin-4-ylmethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carbonitrile |
|---|---|
| PubChem CID | 71032167 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (13S,17R)-17-hydroxy-4,13-dimethyl-17-(pyridin-4-ylmethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carbonitrile |
| SMILES | Cc1c(C#N)ccc2c1CCC1C2CC[C@@]2(C)C1CC[C@@]2(O)Cc1ccncc1 |
| InChI | InChI=1S/C26H30N2O/c1-17-19(16-27)3-4-21-20(17)5-6-23-22(21)7-11-25(2)24(23)8-12-26(25,29)15-18-9-13-28-14-10-18/h3-4,9-10,13-14,22-24,29H,5-8,11-12,15H2,1-2H3/t22?,23?,24?,25-,26+/m0/s1 |
| InChIKey | SGVGCVDBUYXMGG-YOYXNKRWSA-N |
| XLogP | 5.09 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |