C29H37BrO4 — CID 71032617
2-(11-bromo-11-ethyltridecoxy)-6-hydroxyanthracene-9,10-dione (PubChem CID 71032617) has the molecular formula C29H37BrO4 and a molecular weight of 529.52 g/mol. Its IUPAC name is 2-(11-bromo-11-ethyltridecoxy)-6-hydroxyanthracene-9,10-dione.
| Compound Name | 2-(11-bromo-11-ethyltridecoxy)-6-hydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 71032617 |
| Molecular Formula | C29H37BrO4 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 2-(11-bromo-11-ethyltridecoxy)-6-hydroxyanthracene-9,10-dione |
| SMILES | CCC(Br)(CC)CCCCCCCCCCOc1ccc2c(c1)C(=O)c1ccc(O)cc1C2=O |
| InChI | InChI=1S/C29H37BrO4/c1-3-29(30,4-2)17-11-9-7-5-6-8-10-12-18-34-22-14-16-24-26(20-22)28(33)23-15-13-21(31)19-25(23)27(24)32/h13-16,19-20,31H,3-12,17-18H2,1-2H3 |
| InChIKey | OTEXVRHKFCTDNJ-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|