About CID 88940979
CID 88940979 (PubChem CID 88940979) has the molecular formula C29H37BO4
and a molecular weight of 460.42 g/mol.
Molecular Properties
| Compound Name | CID 88940979 |
| PubChem CID | 88940979 |
| Molecular Formula | C29H37BO4 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | — |
| SMILES | [B]C(CC)(CC)CCCCCCCCCCOc1ccc2c(c1)C(=O)c1ccc(O)cc1C2=O |
| InChI | InChI=1S/C29H37BO4/c1-3-29(30,4-2)17-11-9-7-5-6-8-10-12-18-34-22-14-16-24-26(20-22)28(33)23-15-13-21(31)19-25(23)27(24)32/h13-16,19-20,31H,3-12,17-18H2,1-2H3 |
| InChIKey | LLPDMHHLQUAEBK-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88940979 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88940979?
The IUPAC name of CID 88940979 (CID 88940979) is not available.
What is the SMILES notation for CID 88940979?
The canonical SMILES for CID 88940979 is [B]C(CC)(CC)CCCCCCCCCCOc1ccc2c(c1)C(=O)c1ccc(O)cc1C2=O.
What is the InChIKey of CID 88940979?
The InChIKey is LLPDMHHLQUAEBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H37BO4/c1-3-29(30,4-2)17-11-9-7-5-6-8-10-12-18-34-22-14-16-24-26(20-22)28(33)23-15-13-21(31)19-25(23)27(24)32/h13-16,19-20,31H,3-12,17-18H2,1-2H3.
What are the key properties of CID 88940979?
CID 88940979 has a molecular weight of 460.42 g/mol, XLogP of 7.20, 14 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88940979 is sourced from PubChem (CID 88940979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).