C19H32N2O — CID 71038606
N-(diethylaminomethyl)-2,6-dimethyl-4-(2-methylbutan-2-yl)benzamide (PubChem CID 71038606) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is N-(diethylaminomethyl)-2,6-dimethyl-4-(2-methylbutan-2-yl)benzamide.
| Compound Name | N-(diethylaminomethyl)-2,6-dimethyl-4-(2-methylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 71038606 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | N-(diethylaminomethyl)-2,6-dimethyl-4-(2-methylbutan-2-yl)benzamide |
| SMILES | CCN(CC)CNC(=O)c1c(C)cc(C(C)(C)CC)cc1C |
| InChI | InChI=1S/C19H32N2O/c1-8-19(6,7)16-11-14(4)17(15(5)12-16)18(22)20-13-21(9-2)10-3/h11-12H,8-10,13H2,1-7H3,(H,20,22) |
| InChIKey | WBYATAKGNWTHGE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|