C10H18F2O2 — CID 71039348
2-tert-butyl-2-(1,1-difluoropropyl)-1,3-dioxolane (PubChem CID 71039348) has the molecular formula C10H18F2O2 and a molecular weight of 208.25 g/mol. Its IUPAC name is 2-tert-butyl-2-(1,1-difluoropropyl)-1,3-dioxolane.
| Compound Name | 2-tert-butyl-2-(1,1-difluoropropyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 71039348 |
| Molecular Formula | C10H18F2O2 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-tert-butyl-2-(1,1-difluoropropyl)-1,3-dioxolane |
| SMILES | CCC(F)(F)C1(C(C)(C)C)OCCO1 |
| InChI | InChI=1S/C10H18F2O2/c1-5-9(11,12)10(8(2,3)4)13-6-7-14-10/h5-7H2,1-4H3 |
| InChIKey | OVYZRJIRHOVIRU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |