C31H36ClN5O3 — CID 71056890
1-[(5S,8aS)-5-benzyl-7-[(3-chlorophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-(cyclohexa-2,4-dien-1-ylmethyl)-1-propylurea (PubChem CID 71056890) has the molecular formula C31H36ClN5O3 and a molecular weight of 562.11 g/mol. Its IUPAC name is 1-[(5S,8aS)-5-benzyl-7-[(3-chlorophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-(cyclohexa-2,4-dien-1-ylmethyl)-1-propylurea.
| Compound Name | 1-[(5S,8aS)-5-benzyl-7-[(3-chlorophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-(cyclohexa-2,4-dien-1-ylmethyl)-1-propylurea |
|---|---|
| PubChem CID | 71056890 |
| Molecular Formula | C31H36ClN5O3 |
| Molecular Weight | 562.11 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 1-[(5S,8aS)-5-benzyl-7-[(3-chlorophenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-(cyclohexa-2,4-dien-1-ylmethyl)-1-propylurea |
| SMILES | CCCN(C(=O)NCC1C=CC=CC1)N1CC(=O)N2[C@@H](Cc3ccccc3)C(=O)N(Cc3cccc(Cl)c3)C[C@@H]21 |
| InChI | InChI=1S/C31H36ClN5O3/c1-2-16-35(31(40)33-19-24-12-7-4-8-13-24)36-22-29(38)37-27(18-23-10-5-3-6-11-23)30(39)34(21-28(36)37)20-25-14-9-15-26(32)17-25/h3-12,14-15,17,24,27-28H,2,13,16,18-22H2,1H3,(H,33,40)/t24?,27-,28+/m0/s1 |
| InChIKey | PBEOBDDZJKUBNO-SCXVOSTRSA-N |
| XLogP | 4.23 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.11 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |