C9H11N5O6 — CID 71061380
2-aminobutanedioic acid;3,7-dihydropurine-2,6-dione (PubChem CID 71061380) has the molecular formula C9H11N5O6 and a molecular weight of 285.22 g/mol. Its IUPAC name is 2-aminobutanedioic acid;3,7-dihydropurine-2,6-dione.
| Compound Name | 2-aminobutanedioic acid;3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 71061380 |
| Molecular Formula | C9H11N5O6 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-aminobutanedioic acid;3,7-dihydropurine-2,6-dione |
| SMILES | NC(CC(=O)O)C(=O)O.O=c1[nH]c(=O)c2[nH]cnc2[nH]1 |
| InChI | InChI=1S/C5H4N4O2.C4H7NO4/c10-4-2-3(7-1-6-2)8-5(11)9-4;5-2(4(8)9)1-3(6)7/h1H,(H3,6,7,8,9,10,11);2H,1,5H2,(H,6,7)(H,8,9) |
| InChIKey | YGWQVMGGXQLFCH-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 195.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |