C9H14BNO4 — CID 71065996
[5-(morpholin-4-ylmethyl)furan-3-yl]boronic acid (PubChem CID 71065996) has the molecular formula C9H14BNO4 and a molecular weight of 211.03 g/mol. Its IUPAC name is [5-(morpholin-4-ylmethyl)furan-3-yl]boronic acid.
| Compound Name | [5-(morpholin-4-ylmethyl)furan-3-yl]boronic acid |
|---|---|
| PubChem CID | 71065996 |
| Molecular Formula | C9H14BNO4 |
| Molecular Weight | 211.03 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | [5-(morpholin-4-ylmethyl)furan-3-yl]boronic acid |
| SMILES | OB(O)c1coc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C9H14BNO4/c12-10(13)8-5-9(15-7-8)6-11-1-3-14-4-2-11/h5,7,12-13H,1-4,6H2 |
| InChIKey | XVZZDELCMIPCKW-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.03 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|