C11H16N4O3S — CID 71089135
[4-[3-(methyliminomethylimino)propyl]anilino]sulfamic acid (PubChem CID 71089135) has the molecular formula C11H16N4O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is [4-[3-(methyliminomethylimino)propyl]anilino]sulfamic acid.
| Compound Name | [4-[3-(methyliminomethylimino)propyl]anilino]sulfamic acid |
|---|---|
| PubChem CID | 71089135 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | [4-[3-(methyliminomethylimino)propyl]anilino]sulfamic acid |
| SMILES | C/N=C/N=C/CCc1ccc(NNS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H16N4O3S/c1-12-9-13-8-2-3-10-4-6-11(7-5-10)14-15-19(16,17)18/h4-9,14-15H,2-3H2,1H3,(H,16,17,18)/b12-9+,13-8+ |
| InChIKey | RIYSNHWZJAQRBK-GHEQENTPSA-N |
| XLogP | 1.07 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|