C38H62B2O3S2 — CID 71090861
2-[7,7-bis(2-ethylhexyl)-10-(4,4,5,5-tetramethyloxaborolan-2-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 71090861) has the molecular formula C38H62B2O3S2 and a molecular weight of 652.67 g/mol. Its IUPAC name is 2-[7,7-bis(2-ethylhexyl)-10-(4,4,5,5-tetramethyloxaborolan-2-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[7,7-bis(2-ethylhexyl)-10-(4,4,5,5-tetramethyloxaborolan-2-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 71090861 |
| Molecular Formula | C38H62B2O3S2 |
| Molecular Weight | 652.67 g/mol |
| Exact Mass | 652.43 |
| IUPAC Name | 2-[7,7-bis(2-ethylhexyl)-10-(4,4,5,5-tetramethyloxaborolan-2-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCC(CC)CC1(CC(CC)CCCC)c2cc(B3CC(C)(C)C(C)(C)O3)sc2-c2sc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C38H62B2O3S2/c1-13-17-19-26(15-3)23-38(24-27(16-4)20-18-14-2)28-21-30(39-25-34(5,6)35(7,8)41-39)44-32(28)33-29(38)22-31(45-33)40-42-36(9,10)37(11,12)43-40/h21-22,26-27H,13-20,23-25H2,1-12H3 |
| InChIKey | REBSAVUJZRTDRQ-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.67 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|