C29H30IN3 — CID 71094490
3-[(2S,3S)-3-[[2-cyano-2-methyl-1-(4-methylphenyl)propyl]amino]-1-(4-iodophenyl)butan-2-yl]benzonitrile (PubChem CID 71094490) has the molecular formula C29H30IN3 and a molecular weight of 547.48 g/mol. Its IUPAC name is 3-[(2S,3S)-3-[[2-cyano-2-methyl-1-(4-methylphenyl)propyl]amino]-1-(4-iodophenyl)butan-2-yl]benzonitrile.
| Compound Name | 3-[(2S,3S)-3-[[2-cyano-2-methyl-1-(4-methylphenyl)propyl]amino]-1-(4-iodophenyl)butan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 71094490 |
| Molecular Formula | C29H30IN3 |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 3-[(2S,3S)-3-[[2-cyano-2-methyl-1-(4-methylphenyl)propyl]amino]-1-(4-iodophenyl)butan-2-yl]benzonitrile |
| SMILES | Cc1ccc(C(N[C@@H](C)[C@@H](Cc2ccc(I)cc2)c2cccc(C#N)c2)C(C)(C)C#N)cc1 |
| InChI | InChI=1S/C29H30IN3/c1-20-8-12-24(13-9-20)28(29(3,4)19-32)33-21(2)27(17-22-10-14-26(30)15-11-22)25-7-5-6-23(16-25)18-31/h5-16,21,27-28,33H,17H2,1-4H3/t21-,27+,28?/m0/s1 |
| InChIKey | OHFGKAPUVGCKAI-HJFLGKQXSA-N |
| XLogP | 7.07 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|