C27H25FIN3 — CID 89365018
3-[(2S,3S)-3-[[2-cyano-1-(4-fluorophenyl)ethyl]amino]-1-[4-(iodomethyl)phenyl]butan-2-yl]benzonitrile (PubChem CID 89365018) has the molecular formula C27H25FIN3 and a molecular weight of 537.42 g/mol. Its IUPAC name is 3-[(2S,3S)-3-[[2-cyano-1-(4-fluorophenyl)ethyl]amino]-1-[4-(iodomethyl)phenyl]butan-2-yl]benzonitrile.
| Compound Name | 3-[(2S,3S)-3-[[2-cyano-1-(4-fluorophenyl)ethyl]amino]-1-[4-(iodomethyl)phenyl]butan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 89365018 |
| Molecular Formula | C27H25FIN3 |
| Molecular Weight | 537.42 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | 3-[(2S,3S)-3-[[2-cyano-1-(4-fluorophenyl)ethyl]amino]-1-[4-(iodomethyl)phenyl]butan-2-yl]benzonitrile |
| SMILES | C[C@H](NC(CC#N)c1ccc(F)cc1)[C@@H](Cc1ccc(CI)cc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C27H25FIN3/c1-19(32-27(13-14-30)23-9-11-25(28)12-10-23)26(24-4-2-3-22(15-24)18-31)16-20-5-7-21(17-29)8-6-20/h2-12,15,19,26-27,32H,13,16-17H2,1H3/t19-,26+,27?/m0/s1 |
| InChIKey | DZJRHYIWOQYCJK-TWUNHGOMSA-N |
| XLogP | 6.59 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.42 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|