C32H33IN6 — CID 89365088
3-[(2S,3S)-3-[[2-cyano-2-methyl-1-[4-(1H-pyrazol-5-ylamino)phenyl]propyl]amino]-1-[4-(iodomethyl)phenyl]butan-2-yl]benzonitrile (PubChem CID 89365088) has the molecular formula C32H33IN6 and a molecular weight of 628.56 g/mol. Its IUPAC name is 3-[(2S,3S)-3-[[2-cyano-2-methyl-1-[4-(1H-pyrazol-5-ylamino)phenyl]propyl]amino]-1-[4-(iodomethyl)phenyl]butan-2-yl]benzonitrile.
| Compound Name | 3-[(2S,3S)-3-[[2-cyano-2-methyl-1-[4-(1H-pyrazol-5-ylamino)phenyl]propyl]amino]-1-[4-(iodomethyl)phenyl]butan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 89365088 |
| Molecular Formula | C32H33IN6 |
| Molecular Weight | 628.56 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | 3-[(2S,3S)-3-[[2-cyano-2-methyl-1-[4-(1H-pyrazol-5-ylamino)phenyl]propyl]amino]-1-[4-(iodomethyl)phenyl]butan-2-yl]benzonitrile |
| SMILES | C[C@H](NC(c1ccc(Nc2ccn[nH]2)cc1)C(C)(C)C#N)[C@@H](Cc1ccc(CI)cc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C32H33IN6/c1-22(29(27-6-4-5-25(17-27)20-34)18-23-7-9-24(19-33)10-8-23)37-31(32(2,3)21-35)26-11-13-28(14-12-26)38-30-15-16-36-39-30/h4-17,22,29,31,37H,18-19H2,1-3H3,(H2,36,38,39)/t22-,29+,31?/m0/s1 |
| InChIKey | ZISGCUVYWSZXQL-LYSKEXAKSA-N |
| XLogP | 7.56 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.56 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|