C35H31IN4 — CID 71094576
3-[3-[2-cyano-1-[[(2S,3S)-3-(3-cyanophenyl)-4-(4-iodophenyl)butan-2-yl]amino]-2-methylpropyl]phenyl]benzonitrile (PubChem CID 71094576) has the molecular formula C35H31IN4 and a molecular weight of 634.57 g/mol. Its IUPAC name is 3-[3-[2-cyano-1-[[(2S,3S)-3-(3-cyanophenyl)-4-(4-iodophenyl)butan-2-yl]amino]-2-methylpropyl]phenyl]benzonitrile.
| Compound Name | 3-[3-[2-cyano-1-[[(2S,3S)-3-(3-cyanophenyl)-4-(4-iodophenyl)butan-2-yl]amino]-2-methylpropyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 71094576 |
| Molecular Formula | C35H31IN4 |
| Molecular Weight | 634.57 g/mol |
| Exact Mass | 634.16 |
| IUPAC Name | 3-[3-[2-cyano-1-[[(2S,3S)-3-(3-cyanophenyl)-4-(4-iodophenyl)butan-2-yl]amino]-2-methylpropyl]phenyl]benzonitrile |
| SMILES | C[C@H](NC(c1cccc(-c2cccc(C#N)c2)c1)C(C)(C)C#N)[C@@H](Cc1ccc(I)cc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C35H31IN4/c1-24(33(19-25-13-15-32(36)16-14-25)30-11-5-8-27(18-30)22-38)40-34(35(2,3)23-39)31-12-6-10-29(20-31)28-9-4-7-26(17-28)21-37/h4-18,20,24,33-34,40H,19H2,1-3H3/t24-,33+,34?/m0/s1 |
| InChIKey | JWUBVRKZUVVDFA-FCLPEPBRSA-N |
| XLogP | 8.30 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.57 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|