C27H23IN4 — CID 71094488
3-[(2S,3S)-3-[[2-cyano-1-(4-cyanophenyl)ethyl]amino]-1-(4-iodophenyl)butan-2-yl]benzonitrile (PubChem CID 71094488) has the molecular formula C27H23IN4 and a molecular weight of 530.41 g/mol. Its IUPAC name is 3-[(2S,3S)-3-[[2-cyano-1-(4-cyanophenyl)ethyl]amino]-1-(4-iodophenyl)butan-2-yl]benzonitrile.
| Compound Name | 3-[(2S,3S)-3-[[2-cyano-1-(4-cyanophenyl)ethyl]amino]-1-(4-iodophenyl)butan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 71094488 |
| Molecular Formula | C27H23IN4 |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | 3-[(2S,3S)-3-[[2-cyano-1-(4-cyanophenyl)ethyl]amino]-1-(4-iodophenyl)butan-2-yl]benzonitrile |
| SMILES | C[C@H](NC(CC#N)c1ccc(C#N)cc1)[C@@H](Cc1ccc(I)cc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C27H23IN4/c1-19(32-27(13-14-29)23-9-5-21(17-30)6-10-23)26(16-20-7-11-25(28)12-8-20)24-4-2-3-22(15-24)18-31/h2-12,15,19,26-27,32H,13,16H2,1H3/t19-,26+,27?/m0/s1 |
| InChIKey | PZQKRCFMTTZBKZ-TWUNHGOMSA-N |
| XLogP | 5.99 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|