C28H28IN3S — CID 89365036
3-[(2S,3S)-3-[[2-cyano-1-(4-methylsulfanylphenyl)ethyl]amino]-1-[4-(iodomethyl)phenyl]butan-2-yl]benzonitrile (PubChem CID 89365036) has the molecular formula C28H28IN3S and a molecular weight of 565.52 g/mol. Its IUPAC name is 3-[(2S,3S)-3-[[2-cyano-1-(4-methylsulfanylphenyl)ethyl]amino]-1-[4-(iodomethyl)phenyl]butan-2-yl]benzonitrile.
| Compound Name | 3-[(2S,3S)-3-[[2-cyano-1-(4-methylsulfanylphenyl)ethyl]amino]-1-[4-(iodomethyl)phenyl]butan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 89365036 |
| Molecular Formula | C28H28IN3S |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 565.10 |
| IUPAC Name | 3-[(2S,3S)-3-[[2-cyano-1-(4-methylsulfanylphenyl)ethyl]amino]-1-[4-(iodomethyl)phenyl]butan-2-yl]benzonitrile |
| SMILES | CSc1ccc(C(CC#N)N[C@@H](C)[C@@H](Cc2ccc(CI)cc2)c2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C28H28IN3S/c1-20(32-28(14-15-30)24-10-12-26(33-2)13-11-24)27(25-5-3-4-23(16-25)19-31)17-21-6-8-22(18-29)9-7-21/h3-13,16,20,27-28,32H,14,17-18H2,1-2H3/t20-,27+,28?/m0/s1 |
| InChIKey | XJWWLPQUNHMVPA-WKDKRSGCSA-N |
| XLogP | 7.17 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|