C27H32O — CID 71102894
4-[4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexyl]cyclohexa-1,3-dien-1-ol (PubChem CID 71102894) has the molecular formula C27H32O and a molecular weight of 372.55 g/mol. Its IUPAC name is 4-[4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexyl]cyclohexa-1,3-dien-1-ol.
| Compound Name | 4-[4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexyl]cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 71102894 |
| Molecular Formula | C27H32O |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 4-[4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexyl]cyclohexa-1,3-dien-1-ol |
| SMILES | C[C@H](Cc1ccc(C2CCC(C3=CC=C(O)CC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H32O/c1-20(22-5-3-2-4-6-22)19-21-7-9-23(10-8-21)24-11-13-25(14-12-24)26-15-17-27(28)18-16-26/h2-10,15,17,20,24-25,28H,11-14,16,18-19H2,1H3/t20-,24?,25?/m1/s1 |
| InChIKey | JHBVEYNJWRQXKY-NWSMCOELSA-N |
| XLogP | 7.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |