C24H23N3O2S — CID 71104627
N-[(E)-(9-methylcarbazol-3-yl)methylideneamino]-1,1-dioxo-N-phenylthiolan-3-amine (PubChem CID 71104627) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[(E)-(9-methylcarbazol-3-yl)methylideneamino]-1,1-dioxo-N-phenylthiolan-3-amine.
| Compound Name | N-[(E)-(9-methylcarbazol-3-yl)methylideneamino]-1,1-dioxo-N-phenylthiolan-3-amine |
|---|---|
| PubChem CID | 71104627 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[(E)-(9-methylcarbazol-3-yl)methylideneamino]-1,1-dioxo-N-phenylthiolan-3-amine |
| SMILES | Cn1c2ccccc2c2cc(/C=N/N(c3ccccc3)C3CCS(=O)(=O)C3)ccc21 |
| InChI | InChI=1S/C24H23N3O2S/c1-26-23-10-6-5-9-21(23)22-15-18(11-12-24(22)26)16-25-27(19-7-3-2-4-8-19)20-13-14-30(28,29)17-20/h2-12,15-16,20H,13-14,17H2,1H3/b25-16+ |
| InChIKey | XYMVJKSFYGTILX-PCLIKHOPSA-N |
| XLogP | 4.36 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|