C24H24N6O2 — CID 71112255
2-(6-amino-3-pyridinyl)-10-(1-propanoylpiperidin-4-yl)pyrido[3,2-c][1,5]naphthyridin-9-one (PubChem CID 71112255) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 2-(6-amino-3-pyridinyl)-10-(1-propanoylpiperidin-4-yl)pyrido[3,2-c][1,5]naphthyridin-9-one.
| Compound Name | 2-(6-amino-3-pyridinyl)-10-(1-propanoylpiperidin-4-yl)pyrido[3,2-c][1,5]naphthyridin-9-one |
|---|---|
| PubChem CID | 71112255 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-(6-amino-3-pyridinyl)-10-(1-propanoylpiperidin-4-yl)pyrido[3,2-c][1,5]naphthyridin-9-one |
| SMILES | CCC(=O)N1CCC(n2c(=O)ccc3cnc4ccc(-c5ccc(N)nc5)nc4c32)CC1 |
| InChI | InChI=1S/C24H24N6O2/c1-2-21(31)29-11-9-17(10-12-29)30-22(32)8-4-16-14-26-19-6-5-18(28-23(19)24(16)30)15-3-7-20(25)27-13-15/h3-8,13-14,17H,2,9-12H2,1H3,(H2,25,27) |
| InChIKey | UIBUIOOYEWWITG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|