C28H38F3N3O3 — CID 71124343
2-[4-[4-hexylimino-4-[2-[[3-(trifluoromethyl)phenyl]methyl]hydrazinyl]butyl]phenoxy]-2-methylpropanoic acid (PubChem CID 71124343) has the molecular formula C28H38F3N3O3 and a molecular weight of 521.62 g/mol. Its IUPAC name is 2-[4-[4-hexylimino-4-[2-[[3-(trifluoromethyl)phenyl]methyl]hydrazinyl]butyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[4-hexylimino-4-[2-[[3-(trifluoromethyl)phenyl]methyl]hydrazinyl]butyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 71124343 |
| Molecular Formula | C28H38F3N3O3 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | 2-[4-[4-hexylimino-4-[2-[[3-(trifluoromethyl)phenyl]methyl]hydrazinyl]butyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CCCCCC/N=C(\CCCc1ccc(OC(C)(C)C(=O)O)cc1)NNCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H38F3N3O3/c1-4-5-6-7-18-32-25(34-33-20-22-11-8-12-23(19-22)28(29,30)31)13-9-10-21-14-16-24(17-15-21)37-27(2,3)26(35)36/h8,11-12,14-17,19,33H,4-7,9-10,13,18,20H2,1-3H3,(H,32,34)(H,35,36) |
| InChIKey | QPIHQAPGFYJQNA-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|