C24H23F3INO4S — CID 71135289
(4aS,9R,10R,10aR)-10-(dimethylamino)-5,6-dihydroxy-4a-iodo-2-methoxy-9-[4-(trifluoromethyl)phenyl]sulfanyl-4,9,10,10a-tetrahydrophenanthren-3-one (PubChem CID 71135289) has the molecular formula C24H23F3INO4S and a molecular weight of 605.42 g/mol. Its IUPAC name is (4aS,9R,10R,10aR)-10-(dimethylamino)-5,6-dihydroxy-4a-iodo-2-methoxy-9-[4-(trifluoromethyl)phenyl]sulfanyl-4,9,10,10a-tetrahydrophenanthren-3-one.
| Compound Name | (4aS,9R,10R,10aR)-10-(dimethylamino)-5,6-dihydroxy-4a-iodo-2-methoxy-9-[4-(trifluoromethyl)phenyl]sulfanyl-4,9,10,10a-tetrahydrophenanthren-3-one |
|---|---|
| PubChem CID | 71135289 |
| Molecular Formula | C24H23F3INO4S |
| Molecular Weight | 605.42 g/mol |
| Exact Mass | 605.03 |
| IUPAC Name | (4aS,9R,10R,10aR)-10-(dimethylamino)-5,6-dihydroxy-4a-iodo-2-methoxy-9-[4-(trifluoromethyl)phenyl]sulfanyl-4,9,10,10a-tetrahydrophenanthren-3-one |
| SMILES | COC1=C[C@@H]2[C@@H](N(C)C)[C@H](Sc3ccc(C(F)(F)F)cc3)c3ccc(O)c(O)c3[C@]2(I)CC1=O |
| InChI | InChI=1S/C24H23F3INO4S/c1-29(2)20-15-10-18(33-3)17(31)11-23(15,28)19-14(8-9-16(30)21(19)32)22(20)34-13-6-4-12(5-7-13)24(25,26)27/h4-10,15,20,22,30,32H,11H2,1-3H3/t15-,20-,22-,23+/m1/s1 |
| InChIKey | DIDWRFGAKHWDSB-ICYYRSKXSA-N |
| XLogP | 5.64 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|