C26H28N6O5 — CID 71138864
[1-[4-[[6-(2-morpholin-4-ylanilino)-3-nitro-2-pyridinyl]amino]phenyl]cyclobutyl]carbamic acid (PubChem CID 71138864) has the molecular formula C26H28N6O5 and a molecular weight of 504.55 g/mol. Its IUPAC name is [1-[4-[[6-(2-morpholin-4-ylanilino)-3-nitro-2-pyridinyl]amino]phenyl]cyclobutyl]carbamic acid.
| Compound Name | [1-[4-[[6-(2-morpholin-4-ylanilino)-3-nitro-2-pyridinyl]amino]phenyl]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 71138864 |
| Molecular Formula | C26H28N6O5 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | [1-[4-[[6-(2-morpholin-4-ylanilino)-3-nitro-2-pyridinyl]amino]phenyl]cyclobutyl]carbamic acid |
| SMILES | O=C(O)NC1(c2ccc(Nc3nc(Nc4ccccc4N4CCOCC4)ccc3[N+](=O)[O-])cc2)CCC1 |
| InChI | InChI=1S/C26H28N6O5/c33-25(34)30-26(12-3-13-26)18-6-8-19(9-7-18)27-24-22(32(35)36)10-11-23(29-24)28-20-4-1-2-5-21(20)31-14-16-37-17-15-31/h1-2,4-11,30H,3,12-17H2,(H,33,34)(H2,27,28,29) |
| InChIKey | IGNDMJVFSROIIX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 141.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|