C30H36N6O5 — CID 71143901
tert-butyl-[1-[4-[[6-(2-morpholin-4-ylanilino)-3-nitro-2-pyridinyl]amino]phenyl]cyclobutyl]carbamic acid (PubChem CID 71143901) has the molecular formula C30H36N6O5 and a molecular weight of 560.66 g/mol. Its IUPAC name is tert-butyl-[1-[4-[[6-(2-morpholin-4-ylanilino)-3-nitro-2-pyridinyl]amino]phenyl]cyclobutyl]carbamic acid.
| Compound Name | tert-butyl-[1-[4-[[6-(2-morpholin-4-ylanilino)-3-nitro-2-pyridinyl]amino]phenyl]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 71143901 |
| Molecular Formula | C30H36N6O5 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | tert-butyl-[1-[4-[[6-(2-morpholin-4-ylanilino)-3-nitro-2-pyridinyl]amino]phenyl]cyclobutyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1(c2ccc(Nc3nc(Nc4ccccc4N4CCOCC4)ccc3[N+](=O)[O-])cc2)CCC1 |
| InChI | InChI=1S/C30H36N6O5/c1-29(2,3)35(28(37)38)30(15-6-16-30)21-9-11-22(12-10-21)31-27-25(36(39)40)13-14-26(33-27)32-23-7-4-5-8-24(23)34-17-19-41-20-18-34/h4-5,7-14H,6,15-20H2,1-3H3,(H,37,38)(H2,31,32,33) |
| InChIKey | RKGVNWUIIOEAPC-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 133.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|