About 1-O-(2,2-difluoropropyl) 4-O-[5-(hydroxymethyl)-2-adamantyl] butanedioate
1-O-(2,2-difluoropropyl) 4-O-[5-(hydroxymethyl)-2-adamantyl] butanedioate (PubChem CID 71142900) has the molecular formula C18H26F2O5
and a molecular weight of 360.40 g/mol. Its IUPAC name is 1-O-(2,2-difluoropropyl) 4-O-[5-(hydroxymethyl)-2-adamantyl] butanedioate.
Molecular Properties
| Compound Name | 1-O-(2,2-difluoropropyl) 4-O-[5-(hydroxymethyl)-2-adamantyl] butanedioate |
| PubChem CID | 71142900 |
| Molecular Formula | C18H26F2O5 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-O-(2,2-difluoropropyl) 4-O-[5-(hydroxymethyl)-2-adamantyl] butanedioate |
| SMILES | CC(F)(F)COC(=O)CCC(=O)OC1C2CC3CC1CC(CO)(C3)C2 |
| InChI | InChI=1S/C18H26F2O5/c1-17(19,20)10-24-14(22)2-3-15(23)25-16-12-4-11-5-13(16)8-18(6-11,7-12)9-21/h11-13,16,21H,2-10H2,1H3 |
| InChIKey | GMMSIQHZHWWIMO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-O-(2,2-difluoropropyl) 4-O-[5-(hydroxymethyl)-2-adamantyl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2,2-difluoropropyl) 4-O-[5-(hydroxymethyl)-2-adamantyl] butanedioate?
The IUPAC name of 1-O-(2,2-difluoropropyl) 4-O-[5-(hydroxymethyl)-2-adamantyl] butanedioate (CID 71142900) is 1-O-(2,2-difluoropropyl) 4-O-[5-(hydroxymethyl)-2-adamantyl] butanedioate.
What is the SMILES notation for 1-O-(2,2-difluoropropyl) 4-O-[5-(hydroxymethyl)-2-adamantyl] butanedioate?
The canonical SMILES for 1-O-(2,2-difluoropropyl) 4-O-[5-(hydroxymethyl)-2-adamantyl] butanedioate is CC(F)(F)COC(=O)CCC(=O)OC1C2CC3CC1CC(CO)(C3)C2.
What is the InChIKey of 1-O-(2,2-difluoropropyl) 4-O-[5-(hydroxymethyl)-2-adamantyl] butanedioate?
The InChIKey is GMMSIQHZHWWIMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26F2O5/c1-17(19,20)10-24-14(22)2-3-15(23)25-16-12-4-11-5-13(16)8-18(6-11,7-12)9-21/h11-13,16,21H,2-10H2,1H3.
What are the key properties of 1-O-(2,2-difluoropropyl) 4-O-[5-(hydroxymethyl)-2-adamantyl] butanedioate?
1-O-(2,2-difluoropropyl) 4-O-[5-(hydroxymethyl)-2-adamantyl] butanedioate has a molecular weight of 360.40 g/mol, XLogP of 2.70, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2,2-difluoropropyl) 4-O-[5-(hydroxymethyl)-2-adamantyl] butanedioate is sourced from PubChem (CID 71142900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).