C16H22N3OS+ — CID 7116663
3-methyl-2-(2-piperidin-1-ium-1-ylethylsulfanyl)quinazolin-4-one (PubChem CID 7116663) has the molecular formula C16H22N3OS+ and a molecular weight of 304.44 g/mol. Its IUPAC name is 3-methyl-2-(2-piperidin-1-ium-1-ylethylsulfanyl)quinazolin-4-one.
| Compound Name | 3-methyl-2-(2-piperidin-1-ium-1-ylethylsulfanyl)quinazolin-4-one |
|---|---|
| PubChem CID | 7116663 |
| Molecular Formula | C16H22N3OS+ |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 3-methyl-2-(2-piperidin-1-ium-1-ylethylsulfanyl)quinazolin-4-one |
| SMILES | Cn1c(SCC[NH+]2CCCCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C16H21N3OS/c1-18-15(20)13-7-3-4-8-14(13)17-16(18)21-12-11-19-9-5-2-6-10-19/h3-4,7-8H,2,5-6,9-12H2,1H3/p+1 |
| InChIKey | PSPWEXKCXRGGQZ-UHFFFAOYSA-O |
| XLogP | 1.09 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |