C22H17F3N4 — CID 71180773
N-methyl-6-(3-methylphenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine (PubChem CID 71180773) has the molecular formula C22H17F3N4 and a molecular weight of 394.40 g/mol. Its IUPAC name is N-methyl-6-(3-methylphenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine.
| Compound Name | N-methyl-6-(3-methylphenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 71180773 |
| Molecular Formula | C22H17F3N4 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-methyl-6-(3-methylphenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine |
| SMILES | CNc1nc(-c2ccc(C(F)(F)F)nc2)nc2ccc(-c3cccc(C)c3)cc12 |
| InChI | InChI=1S/C22H17F3N4/c1-13-4-3-5-14(10-13)15-6-8-18-17(11-15)21(26-2)29-20(28-18)16-7-9-19(27-12-16)22(23,24)25/h3-12H,1-2H3,(H,26,28,29) |
| InChIKey | NDVUUKKXJGZBJS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |