C24H32INO6S — CID 71181995
(4-methoxyphenyl)methyl (2R)-3-[(1S)-1-iodo-4-(methylsulfanylmethoxy)cyclohexa-2,4-dien-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 71181995) has the molecular formula C24H32INO6S and a molecular weight of 589.49 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2R)-3-[(1S)-1-iodo-4-(methylsulfanylmethoxy)cyclohexa-2,4-dien-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | (4-methoxyphenyl)methyl (2R)-3-[(1S)-1-iodo-4-(methylsulfanylmethoxy)cyclohexa-2,4-dien-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 71181995 |
| Molecular Formula | C24H32INO6S |
| Molecular Weight | 589.49 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | (4-methoxyphenyl)methyl (2R)-3-[(1S)-1-iodo-4-(methylsulfanylmethoxy)cyclohexa-2,4-dien-1-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COc1ccc(COC(=O)[C@@H](C[C@]2(I)C=CC(OCSC)=CC2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H32INO6S/c1-23(2,3)32-22(28)26-20(14-24(25)12-10-19(11-13-24)31-16-33-5)21(27)30-15-17-6-8-18(29-4)9-7-17/h6-12,20H,13-16H2,1-5H3,(H,26,28)/t20-,24+/m1/s1 |
| InChIKey | OMJVPELLQBACLJ-YKSBVNFPSA-N |
| XLogP | 5.38 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|