C26H41FO — CID 71216016
(2S,6R,9S,12S,16S,17E)-17-(1-fluoroethylidene)-4,4,9,12,16-pentamethyl-3-oxapentacyclo[11.7.0.02,6.07,12.016,20]icosane (PubChem CID 71216016) has the molecular formula C26H41FO and a molecular weight of 388.61 g/mol. Its IUPAC name is (2S,6R,9S,12S,16S,17E)-17-(1-fluoroethylidene)-4,4,9,12,16-pentamethyl-3-oxapentacyclo[11.7.0.02,6.07,12.016,20]icosane.
| Compound Name | (2S,6R,9S,12S,16S,17E)-17-(1-fluoroethylidene)-4,4,9,12,16-pentamethyl-3-oxapentacyclo[11.7.0.02,6.07,12.016,20]icosane |
|---|---|
| PubChem CID | 71216016 |
| Molecular Formula | C26H41FO |
| Molecular Weight | 388.61 g/mol |
| Exact Mass | 388.31 |
| IUPAC Name | (2S,6R,9S,12S,16S,17E)-17-(1-fluoroethylidene)-4,4,9,12,16-pentamethyl-3-oxapentacyclo[11.7.0.02,6.07,12.016,20]icosane |
| SMILES | C/C(F)=C1/CCC2C3C(CC[C@]12C)[C@@]1(C)CC[C@H](C)CC1[C@H]1CC(C)(C)O[C@H]31 |
| InChI | InChI=1S/C26H41FO/c1-15-9-11-26(6)20-10-12-25(5)18(16(2)27)7-8-19(25)22(20)23-17(21(26)13-15)14-24(3,4)28-23/h15,17,19-23H,7-14H2,1-6H3/b18-16+/t15-,17+,19?,20?,21?,22?,23-,25+,26+/m0/s1 |
| InChIKey | XMEJRHCGCFAXIU-RDDDJCCBSA-N |
| XLogP | 7.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.61 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |