C24H23ClN2O4S — CID 71218374
2-[5-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-6-chloro-1-benzothiophen-3-yl]-2-oxoacetic acid (PubChem CID 71218374) has the molecular formula C24H23ClN2O4S and a molecular weight of 470.98 g/mol. Its IUPAC name is 2-[5-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-6-chloro-1-benzothiophen-3-yl]-2-oxoacetic acid.
| Compound Name | 2-[5-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-6-chloro-1-benzothiophen-3-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 71218374 |
| Molecular Formula | C24H23ClN2O4S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 2-[5-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-6-chloro-1-benzothiophen-3-yl]-2-oxoacetic acid |
| SMILES | C[C@@H]1CN(Cc2ccccc2)[C@@H](C)CN1C(=O)c1cc2c(C(=O)C(=O)O)csc2cc1Cl |
| InChI | InChI=1S/C24H23ClN2O4S/c1-14-11-27(15(2)10-26(14)12-16-6-4-3-5-7-16)23(29)18-8-17-19(22(28)24(30)31)13-32-21(17)9-20(18)25/h3-9,13-15H,10-12H2,1-2H3,(H,30,31)/t14-,15+/m0/s1 |
| InChIKey | SQYHSTOQGVCMLS-LSDHHAIUSA-N |
| XLogP | 4.56 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|