C23H22ClN3O4S — CID 89382371
2-[3-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-2-chlorothieno[3,4-b]pyridin-5-yl]-2-oxoacetic acid (PubChem CID 89382371) has the molecular formula C23H22ClN3O4S and a molecular weight of 471.97 g/mol. Its IUPAC name is 2-[3-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-2-chlorothieno[3,4-b]pyridin-5-yl]-2-oxoacetic acid.
| Compound Name | 2-[3-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-2-chlorothieno[3,4-b]pyridin-5-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 89382371 |
| Molecular Formula | C23H22ClN3O4S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 2-[3-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-2-chlorothieno[3,4-b]pyridin-5-yl]-2-oxoacetic acid |
| SMILES | C[C@@H]1CN(Cc2ccccc2)[C@@H](C)CN1C(=O)c1cc2c(C(=O)C(=O)O)scc2nc1Cl |
| InChI | InChI=1S/C23H22ClN3O4S/c1-13-10-27(14(2)9-26(13)11-15-6-4-3-5-7-15)22(29)17-8-16-18(25-21(17)24)12-32-20(16)19(28)23(30)31/h3-8,12-14H,9-11H2,1-2H3,(H,30,31)/t13-,14+/m0/s1 |
| InChIKey | KEUHGDZJJPILGD-UONOGXRCSA-N |
| XLogP | 3.95 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|