C14H17IN6O4S — CID 71220312
[(2R,3R)-5-[2-(4-aminobut-2-ynylamino)-6-sulfanylidene-3H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl hypoiodite (PubChem CID 71220312) has the molecular formula C14H17IN6O4S and a molecular weight of 492.30 g/mol. Its IUPAC name is [(2R,3R)-5-[2-(4-aminobut-2-ynylamino)-6-sulfanylidene-3H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl hypoiodite.
| Compound Name | [(2R,3R)-5-[2-(4-aminobut-2-ynylamino)-6-sulfanylidene-3H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl hypoiodite |
|---|---|
| PubChem CID | 71220312 |
| Molecular Formula | C14H17IN6O4S |
| Molecular Weight | 492.30 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | [(2R,3R)-5-[2-(4-aminobut-2-ynylamino)-6-sulfanylidene-3H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl hypoiodite |
| SMILES | NCC#CCNc1nc(=S)c2ncn(C3O[C@H](COI)[C@H](O)C3O)c2[nH]1 |
| InChI | InChI=1S/C14H17IN6O4S/c15-24-5-7-9(22)10(23)13(25-7)21-6-18-8-11(21)19-14(20-12(8)26)17-4-2-1-3-16/h6-7,9-10,13,22-23H,3-5,16H2,(H2,17,19,20,26)/t7-,9+,10?,13?/m1/s1 |
| InChIKey | SBHJIHWBUPUTSI-SUEJUAHQSA-N |
| XLogP | -0.15 |
| TPSA | 143.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.30 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|