C17H22N6O4S — CID 89006814
2-(6-aminohexa-2,4-diynylamino)-9-[1-[(2R)-1,3,4-trihydroxybutan-2-yl]oxyethyl]-3H-purine-6-thione (PubChem CID 89006814) has the molecular formula C17H22N6O4S and a molecular weight of 406.47 g/mol. Its IUPAC name is 2-(6-aminohexa-2,4-diynylamino)-9-[1-[(2R)-1,3,4-trihydroxybutan-2-yl]oxyethyl]-3H-purine-6-thione.
| Compound Name | 2-(6-aminohexa-2,4-diynylamino)-9-[1-[(2R)-1,3,4-trihydroxybutan-2-yl]oxyethyl]-3H-purine-6-thione |
|---|---|
| PubChem CID | 89006814 |
| Molecular Formula | C17H22N6O4S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-(6-aminohexa-2,4-diynylamino)-9-[1-[(2R)-1,3,4-trihydroxybutan-2-yl]oxyethyl]-3H-purine-6-thione |
| SMILES | CC(O[C@H](CO)C(O)CO)n1cnc2c(=S)nc(NCC#CC#CCN)[nH]c21 |
| InChI | InChI=1S/C17H22N6O4S/c1-11(27-13(9-25)12(26)8-24)23-10-20-14-15(23)21-17(22-16(14)28)19-7-5-3-2-4-6-18/h10-13,24-26H,6-9,18H2,1H3,(H2,19,21,22,28)/t11?,12?,13-/m1/s1 |
| InChIKey | OTCNXONGDRAHCB-WXRRBKDZSA-N |
| XLogP | -0.88 |
| TPSA | 154.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|